Difference between revisions of "DELTA-TOCOPHEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Oleoyl-ACPs == * common-name: ** an oleoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16077 * RXN-16629 == React...")
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Oleoyl-ACPs ==
+
== Metabolite DELTA-TOCOPHEROL ==
 
* common-name:
 
* common-name:
** an oleoyl-[acp]
+
** δ-tocopherol
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
 +
* inchi-key:
 +
** gzifeoyasatjeh-vhfrwlagsa-n
 +
* molecular-weight:
 +
** 402.659
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16077]]
+
* [[RXN-2562]]
* [[RXN-16629]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16628]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oleoyl-[acp]}}
+
{{#set: common-name=δ-tocopherol}}
 +
{{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}}
 +
{{#set: molecular-weight=402.659}}

Latest revision as of 11:17, 18 March 2021

Metabolite DELTA-TOCOPHEROL

  • common-name:
    • δ-tocopherol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
  • inchi-key:
    • gzifeoyasatjeh-vhfrwlagsa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality