Difference between revisions of "DELTA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oleoyl-ACPs == * common-name: ** an oleoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16077 * RXN-16629 == React...") |
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DELTA-TOCOPHEROL == |
* common-name: | * common-name: | ||
− | ** | + | ** δ-tocopherol |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) | ||
+ | * inchi-key: | ||
+ | ** gzifeoyasatjeh-vhfrwlagsa-n | ||
+ | * molecular-weight: | ||
+ | ** 402.659 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-2562]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=δ-tocopherol}} |
+ | {{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}} | ||
+ | {{#set: molecular-weight=402.659}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite DELTA-TOCOPHEROL
- common-name:
- δ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
- inchi-key:
- gzifeoyasatjeh-vhfrwlagsa-n
- molecular-weight:
- 402.659