Difference between revisions of "DELTA-TOCOPHEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] == * direction: ** left-to-right * common-name: ** formaldehyde dehydrogenase *...")
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2962 RXN-2962] ==
+
== Metabolite DELTA-TOCOPHEROL ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** formaldehyde dehydrogenase
+
** δ-tocopherol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.284 ec-1.1.1.284]
+
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[S-HYDROXYMETHYLGLUTATHIONE]][c] '''=>''' 1 [[CPD-548]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
+
** gzifeoyasatjeh-vhfrwlagsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ21601]]
+
** 402.659
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-2562]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=δ-tocopherol}}
−
* [[PWY-1801]], formaldehyde oxidation II (glutathione-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801]
+
{{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=402.659}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06983 R06983]
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07140 R07140]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=formaldehyde dehydrogenase}}
 
−
{{#set: ec-number=ec-1.1.1.284}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DELTA-TOCOPHEROL

  • common-name:
    • δ-tocopherol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
  • inchi-key:
    • gzifeoyasatjeh-vhfrwlagsa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DELTA-TOCOPHEROL&oldid=139502"