Difference between revisions of "DELTA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-23-DIOXYGENASE-RXN INDOLE-23-DIOXYGENASE-RXN] == * direction: ** left-to-right * ec-number:...") |
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DELTA-TOCOPHEROL == |
| − | * | + | * common-name: |
| − | ** | + | ** δ-tocopherol |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) |
| − | + | * inchi-key: | |
| − | + | ** gzifeoyasatjeh-vhfrwlagsa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 402.659 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-2562]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=δ-tocopherol}} | |
| − | == | + | {{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}} |
| − | + | {{#set: molecular-weight=402.659}} | |
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite DELTA-TOCOPHEROL
- common-name:
- δ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
- inchi-key:
- gzifeoyasatjeh-vhfrwlagsa-n
- molecular-weight:
- 402.659
