Difference between revisions of "DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-3-hydroxypetroselinoyl-ACPs == * common-name: ** a (3r)-3-hydroxypetroselinoyl-[acp] == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-2,3,4,5-tetrahydrodipicolinate |
| + | * smiles: | ||
| + | ** c1(cc(=nc(c1)c([o-])=o)c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** cxmbcxqhoxuceo-bypyzucnsa-l | ||
| + | * molecular-weight: | ||
| + | ** 169.137 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14246]] | ||
| + | * [[RXN-7737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14014]] |
| + | * [[RXN-14246]] | ||
| + | * [[RXN-7737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}} |
| + | {{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}} | ||
| + | {{#set: molecular-weight=169.137}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE
- common-name:
- (s)-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
- inchi-key:
- cxmbcxqhoxuceo-bypyzucnsa-l
- molecular-weight:
- 169.137
