Difference between revisions of "DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22161 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RETINOLSAT ** Category...") |
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == |
− | == | + | * common-name: |
− | * [[ | + | ** (s)-2,3,4,5-tetrahydrodipicolinate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c1(cc(=nc(c1)c([o-])=o)c([o-])=o) |
− | * | + | * inchi-key: |
− | * | + | ** cxmbcxqhoxuceo-bypyzucnsa-l |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 169.137 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14246]] | ||
+ | * [[RXN-7737]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14014]] | ||
+ | * [[RXN-14246]] | ||
+ | * [[RXN-7737]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}} | ||
+ | {{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}} | ||
+ | {{#set: molecular-weight=169.137}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE
- common-name:
- (s)-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
- inchi-key:
- cxmbcxqhoxuceo-bypyzucnsa-l
- molecular-weight:
- 169.137