Difference between revisions of "DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06713 == * transcription-direction: ** positive * right-end-position: ** 270295 * left-end-position: ** 260962 * centisome-position: ** 55.28926...")
 
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06713 ==
+
== Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (s)-2,3,4,5-tetrahydrodipicolinate
−
* right-end-position:
+
* smiles:
−
** 270295
+
** c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 260962
+
** cxmbcxqhoxuceo-bypyzucnsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 55.28926   
+
** 169.137
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14246]]
−
== Reaction(s) associated ==
+
* [[RXN-7737]]
−
* [[R230-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-14014]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14246]]
−
* [[RXN-13927]]
+
* [[RXN-7737]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}}
−
* [[P261-PWY]]
+
{{#set: molecular-weight=169.137}}
−
** '''1''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6642]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=270295}}
 
−
{{#set: left-end-position=260962}}
 
−
{{#set: centisome-position=55.28926    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE

  • common-name:
    • (s)-2,3,4,5-tetrahydrodipicolinate
  • smiles:
    • c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
  • inchi-key:
    • cxmbcxqhoxuceo-bypyzucnsa-l
  • molecular-weight:
    • 169.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE&oldid=137020"