Difference between revisions of "DELTA3-ISOPENTENYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERPHOSPHA-RXN PSERPHOSPHA-RXN] == * direction: ** left-to-right * common-name: ** l-3-phosphoseri...")
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERPHOSPHA-RXN PSERPHOSPHA-RXN] ==
+
== Metabolite DELTA3-ISOPENTENYL-PP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-3-phosphoserine phosphatase
+
** isopentenyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.3 ec-3.1.3.3]
+
** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[PROTON]][c] '''+''' 1 [[Phosphoserines]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Serines]][c]
+
** nuhsrofqtuxzqq-uhfffaoysa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09777]]
+
** 243.069
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
−
** Category: [[orthology]]
+
* [[FPPS]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[FPPSYN-RXN]]
−
== Pathway(s)  ==
+
* [[GGPS]]
−
== Reconstruction information  ==
+
* [[GPPS]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GPPSYN-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[IDI]]
−
== External links  ==
+
* [[IPPISOM-RXN]]
−
* UNIPROT:
+
* [[RXN-10068]]
−
** [http://www.uniprot.org/uniprot/Q58989 Q58989]
+
* [[RXN-11486]]
−
** [http://www.uniprot.org/uniprot/O25367 O25367]
+
* [[RXN-11488]]
−
** [http://www.uniprot.org/uniprot/Q9JUR1 Q9JUR1]
+
* [[RXN-11963]]
−
** [http://www.uniprot.org/uniprot/Q9CHW3 Q9CHW3]
+
* [[RXN-8999]]
−
** [http://www.uniprot.org/uniprot/Q9PIL4 Q9PIL4]
+
* [[RXN-9969]]
−
** [http://www.uniprot.org/uniprot/P44997 P44997]
+
* [[RXN0-5180]]
−
** [http://www.uniprot.org/uniprot/P0AGB0 P0AGB0]
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
−
** [http://www.uniprot.org/uniprot/P42941 P42941]
+
== Reaction(s) known to produce the compound ==
−
** [http://www.uniprot.org/uniprot/Q49823 Q49823]
+
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
−
** [http://www.uniprot.org/uniprot/O82796 O82796]
+
* [[GPPSYN-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[IDS1]]
−
{{#set: common-name=l-3-phosphoserine phosphatase}}
+
* [[IPPISOM-RXN]]
−
{{#set: ec-number=ec-3.1.3.3}}
+
* [[ISPH2-RXN]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-10068]]
−
{{#set: nb pathway associated=0}}
+
* [[RXN-11963]]
−
{{#set: reconstruction category=orthology|annotation}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common-name=isopentenyl diphosphate}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
+
{{#set: molecular-weight=243.069}}

Latest revision as of 11:16, 18 March 2021

Metabolite DELTA3-ISOPENTENYL-PP

  • common-name:
    • isopentenyl diphosphate
  • smiles:
    • c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
  • inchi-key:
    • nuhsrofqtuxzqq-uhfffaoysa-k
  • molecular-weight:
    • 243.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DELTA3-ISOPENTENYL-PP&oldid=139018"