|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9537 RXN-9537] == | + | == Metabolite DELTA3-ISOPENTENYL-PP == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** fatty acid synthase | + | ** isopentenyl diphosphate |
| − | ** (3r)-3-hydroxymyristoyl-[acyl-carrier protein] dehydratase | + | * smiles: |
| − | * ec-number: | + | ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86] | + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.85 ec-2.3.1.85]
| + | ** nuhsrofqtuxzqq-uhfffaoysa-k |
| − | ** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59] | + | * molecular-weight: |
| − | * synonymous:
| + | ** 243.069 |
| − | ** (3r)-hydroxymyristoyl-acp dehydratase | + | == Reaction(s) known to consume the compound == |
| − | == Reaction formula == | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
| − | * 1 [[R-3-hydroxymyristoyl-ACPs]][c] '''=>''' 1 [[Tetradec-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
| + | * [[FPPS]] |
| − | == Gene(s) associated with this reaction ==
| + | * [[FPPSYN-RXN]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[GGPS]] |
| − | * Gene: [[SJ17743]] | + | * [[GPPS]] |
| − | ** Category: [[annotation]] | + | * [[GPPSYN-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[IDI]] |
| − | * Gene: [[SJ13014]] | + | * [[IPPISOM-RXN]] |
| − | ** Category: [[annotation]] | + | * [[RXN-10068]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[RXN-11486]] |
| − | * Gene: [[SJ04443]]
| + | * [[RXN-11488]] |
| − | ** Category: [[annotation]] | + | * [[RXN-11963]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[RXN-8999]] |
| − | * Gene: [[SJ00613]]
| + | * [[RXN-9969]] |
| − | ** Category: [[annotation]] | + | * [[RXN0-5180]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] |
| − | * Gene: [[SJ04769]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]] | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[GPPSYN-RXN]] |
| − | * Gene: [[SJ03883]]
| + | * [[IDS1]] |
| − | ** Category: [[annotation]] | + | * [[IPPISOM-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[ISPH2-RXN]] |
| − | * Gene: [[SJ19629]]
| + | * [[RXN-10068]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-11963]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ18059]]
| + | {{#set: common-name=isopentenyl diphosphate}} |
| − | ** Category: [[annotation]] | + | {{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: molecular-weight=243.069}} |
| − | * Gene: [[SJ06617]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11672]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ00320]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ10624]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ06944]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ06616]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ15983]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ10275]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
| |
| − | ** '''31''' reactions found over '''31''' reactions in the full pathway
| |
| − | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
| |
| − | ** '''31''' reactions found over '''31''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links ==
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=fatty acid synthase|(3r)-3-hydroxymyristoyl-[acyl-carrier protein] dehydratase}} | |
| − | {{#set: ec-number=ec-2.3.1.86|ec-4.2.1.59|ec-2.3.1.85}} | |
| − | {{#set: synonymous=(3r)-hydroxymyristoyl-acp dehydratase}} | |
| − | {{#set: nb gene associated=16}}
| |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
