Difference between revisions of "DELTA3-ISOPENTENYL-PP"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite MESO-DIAMINOPIMELATE ==
+== Metabolite DELTA3-ISOPENTENYL-PP ==
 * common-name:
-** meso-diaminopimelate
+** isopentenyl diphosphate
 * smiles:
-** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
+** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
 * inchi-key:
-** gmkmezvlhjarhf-sydprgilsa-n
+** nuhsrofqtuxzqq-uhfffaoysa-k
 * molecular-weight:
-** 190.199
+** 243.069
 == Reaction(s) known to consume the compound ==
-* [[DIAMINOPIMDECARB-RXN]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+* [[FPPS]]
-* [[DIAMINOPIMEPIM-RXN]]
+* [[FPPSYN-RXN]]
-* [[RXN-14246]]
+* [[GGPS]]
+* [[GPPS]]
+* [[GPPSYN-RXN]]
+* [[IDI]]
+* [[IPPISOM-RXN]]
+* [[RXN-10068]]
+* [[RXN-11486]]
+* [[RXN-11488]]
+* [[RXN-11963]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
+* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
-* [[DIAMINOPIMEPIM-RXN]]
+* [[GPPSYN-RXN]]
-* [[RXN-14246]]
+* [[IDS1]]
+* [[IPPISOM-RXN]]
+* [[ISPH2-RXN]]
+* [[RXN-10068]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=meso-diaminopimelate}}
+{{#set: common-name=isopentenyl diphosphate}}
-{{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}}
+{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
-{{#set: molecular-weight=190.199}}
+{{#set: molecular-weight=243.069}}