Difference between revisions of "DEOXY-D-RIBOSE-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08953 == * transcription-direction: ** negative * right-end-position: ** 119860 * left-end-position: ** 116617 * centisome-position: ** 27.213707...")
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08953 ==
+
== Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE ==
* transcription-direction:
+
* common-name:
** negative
+
** 2-deoxy-α-d-ribose 1-phosphate
* right-end-position:
+
* smiles:
** 119860
+
** c1(c(o)c(co)oc1op(=o)([o-])[o-])
* left-end-position:
+
* inchi-key:
** 116617
+
** kbdkajntykvsek-vpeninkcsa-l
* centisome-position:
+
* molecular-weight:
** 27.213707   
+
** 212.096
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[D-PPENTOMUT-RXN]]
== Reaction(s) associated ==
+
* [[DEOXYADENPHOSPHOR-RXN]]
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
** Category: [[annotation]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14029]]
** Category: [[orthology]]
+
* [[URA-PHOSPH-RXN]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[D-PPENTOMUT-RXN]]
* [[GLYOXIII-RXN]]
+
* [[DEOXYADENPHOSPHOR-RXN]]
** Category: [[orthology]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[DEOXYINOPHOSPHOR-RXN]]
* [[HPPD]]
+
* [[RXN-14029]]
** Category: [[orthology]]
+
* [[URA-PHOSPH-RXN]]
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-10815]]
+
{{#set: common-name=2-deoxy-α-d-ribose 1-phosphate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=kbdkajntykvsek-vpeninkcsa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=212.096}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7432]]
 
** '''3''' reactions found over '''2''' reactions in the full pathway
 
* [[TYRFUMCAT-PWY]]
 
** '''2''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-1581]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-1422]]
 
** '''5''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6318]]
 
** '''4''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=119860}}
 
{{#set: left-end-position=116617}}
 
{{#set: centisome-position=27.213707    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE

  • common-name:
    • 2-deoxy-α-d-ribose 1-phosphate
  • smiles:
    • c1(c(o)c(co)oc1op(=o)([o-])[o-])
  • inchi-key:
    • kbdkajntykvsek-vpeninkcsa-l
  • molecular-weight:
    • 212.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality