Difference between revisions of "DEOXY-D-RIBOSE-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02202 == * transcription-direction: ** negative * right-end-position: ** 93206 * left-end-position: ** 85088 * centisome-position: ** 15.655422...")
 
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02202 ==
+
== Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 2-deoxy-α-d-ribose 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 93206
+
** c1(c(o)c(co)oc1op(=o)([o-])[o-])
−
* left-end-position:
+
* inchi-key:
−
** 85088
+
** kbdkajntykvsek-vpeninkcsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 15.655422   
+
** 212.096
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[D-PPENTOMUT-RXN]]
−
== Reaction(s) associated ==
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
* [[PEROXID-RXN]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
** Category: [[annotation]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14029]]
−
* [[RXN-14240]]
+
* [[URA-PHOSPH-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[D-PPENTOMUT-RXN]]
−
* [[RXN-15288]]
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
** Category: [[annotation]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYINOPHOSPHOR-RXN]]
−
* [[RXN-17352]]
+
* [[RXN-14029]]
−
** Category: [[annotation]]
+
* [[URA-PHOSPH-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-8635]]
+
{{#set: common-name=2-deoxy-α-d-ribose 1-phosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=kbdkajntykvsek-vpeninkcsa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=212.096}}
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=93206}}
 
−
{{#set: left-end-position=85088}}
 
−
{{#set: centisome-position=15.655422    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE

  • common-name:
    • 2-deoxy-α-d-ribose 1-phosphate
  • smiles:
    • c1(c(o)c(co)oc1op(=o)([o-])[o-])
  • inchi-key:
    • kbdkajntykvsek-vpeninkcsa-l
  • molecular-weight:
    • 212.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DEOXY-D-RIBOSE-1-PHOSPHATE&oldid=138299"