Difference between revisions of "DEOXY-D-RIBOSE-1-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-28 == * common-name: ** pregn-5-ene-3,20-dione * smiles: ** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inchi-...")
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD66-28 ==
+
== Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE ==
 
* common-name:
 
* common-name:
−
** pregn-5-ene-3,20-dione
+
** 2-deoxy-α-d-ribose 1-phosphate
 
* smiles:
 
* smiles:
−
** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** c1(c(o)c(co)oc1op(=o)([o-])[o-])
 
* inchi-key:
 
* inchi-key:
−
** mnrhzpcieglwgk-lekssakusa-n
+
** kbdkajntykvsek-vpeninkcsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 314.467
+
** 212.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-353]]
+
* [[D-PPENTOMUT-RXN]]
 +
* [[DEOXYADENPHOSPHOR-RXN]]
 +
* [[DEOXYGUANPHOSPHOR-RXN]]
 +
* [[DEOXYINOPHOSPHOR-RXN]]
 +
* [[RXN-14029]]
 +
* [[URA-PHOSPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN66-353]]
+
* [[D-PPENTOMUT-RXN]]
 +
* [[DEOXYADENPHOSPHOR-RXN]]
 +
* [[DEOXYGUANPHOSPHOR-RXN]]
 +
* [[DEOXYINOPHOSPHOR-RXN]]
 +
* [[RXN-14029]]
 +
* [[URA-PHOSPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=pregn-5-ene-3,20-dione}}
+
{{#set: common-name=2-deoxy-α-d-ribose 1-phosphate}}
−
{{#set: inchi-key=inchikey=mnrhzpcieglwgk-lekssakusa-n}}
+
{{#set: inchi-key=inchikey=kbdkajntykvsek-vpeninkcsa-l}}
−
{{#set: molecular-weight=314.467}}
+
{{#set: molecular-weight=212.096}}

Latest revision as of 11:14, 18 March 2021

Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE

  • common-name:
    • 2-deoxy-α-d-ribose 1-phosphate
  • smiles:
    • c1(c(o)c(co)oc1op(=o)([o-])[o-])
  • inchi-key:
    • kbdkajntykvsek-vpeninkcsa-l
  • molecular-weight:
    • 212.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DEOXY-D-RIBOSE-1-PHOSPHATE&oldid=138299"