Difference between revisions of "DEOXY-RIBOSE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9865 == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite DEOXY-RIBOSE-5P == * common-name: ** 2-deoxy-d-ribose 5-phosphate == Reaction(s) known to consume the compound == * D-PPENTOMUT-RXN =...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9865 ==
+
== Metabolite DEOXY-RIBOSE-5P ==
 
* common-name:
 
* common-name:
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
+
** 2-deoxy-d-ribose 5-phosphate
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** fyllwsgfaaqkhu-gbbrockzsa-n
 
* molecular-weight:
 
** 805.321
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[D-PPENTOMUT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9233]]
+
* [[D-PPENTOMUT-RXN]]
 +
* [[RXN-14223]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
+
{{#set: common-name=2-deoxy-d-ribose 5-phosphate}}
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
 
{{#set: molecular-weight=805.321}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite DEOXY-RIBOSE-5P

  • common-name:
    • 2-deoxy-d-ribose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality