Difference between revisions of "DEOXY-RIBOSE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11316 == * transcription-direction: ** positive * right-end-position: ** 222098 * left-end-position: ** 213143 * centisome-position: ** 57.06197...")
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11316 ==
+
== Metabolite 4-METHYL-MYO-INOSITOL ==
* transcription-direction:
+
* common-name:
** positive
+
** d-ononitol
* right-end-position:
+
* smiles:
** 222098
+
** coc1(c(o)c(o)c(o)c(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 213143
+
** dscffeyyqksrsv-geskjzqwsa-n
* centisome-position:
+
* molecular-weight:
** 57.06197   
+
** 194.184
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8281]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.4.13.9-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=d-ononitol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=194.184}}
{{#set: right-end-position=222098}}
 
{{#set: left-end-position=213143}}
 
{{#set: centisome-position=57.06197    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite 4-METHYL-MYO-INOSITOL

  • common-name:
    • d-ononitol
  • smiles:
    • coc1(c(o)c(o)c(o)c(o)c(o)1)
  • inchi-key:
    • dscffeyyqksrsv-geskjzqwsa-n
  • molecular-weight:
    • 194.184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality