Difference between revisions of "DEOXYADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12220 == * transcription-direction: ** positive * right-end-position: ** 663725 * left-end-position: ** 654983 * centisome-position: ** 85.63011...")
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12220 ==
+
== Metabolite DEOXYADENOSINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2'-deoxyadenosine
−
* right-end-position:
+
* smiles:
−
** 663725
+
** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23)))
−
* left-end-position:
+
* inchi-key:
−
** 654983
+
** olxzpdwkrnyjjz-rrkcrqdmsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 85.63011   
+
** 251.244
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADDALT-RXN]]
−
== Reaction(s) associated ==
+
* [[DAMPH]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
* [[3.1.1.64-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[DAMPH]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYADENPHOSPHOR-RXN]]
−
* [[CARBOXYLESTERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2'-deoxyadenosine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=olxzpdwkrnyjjz-rrkcrqdmsa-n}}
−
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
{{#set: molecular-weight=251.244}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10711]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10767]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12252]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12575]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[TRNA-CHARGING-PWY]]
 
−
** '''21''' reactions found over '''21''' reactions in the full pathway
 
−
* [[PWY-6303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=663725}}
 
−
{{#set: left-end-position=654983}}
 
−
{{#set: centisome-position=85.63011    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=9}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite DEOXYADENOSINE

  • common-name:
    • 2'-deoxyadenosine
  • smiles:
    • c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23)))
  • inchi-key:
    • olxzpdwkrnyjjz-rrkcrqdmsa-n
  • molecular-weight:
    • 251.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DEOXYADENOSINE&oldid=138067"