Difference between revisions of "DEOXYCYTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7010 == * smiles: ** c(o)c3(oc(oc2(c(o)c(o)c(oc1(=cc=c(c=c1)cc(c([a [glycogenin]])=o)n[a [glycogenin]]))oc(co)2))c(o)c(o)c(o)3) * com...") |
(Created page with "Category:metabolite == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == * common-name: ** sn-glycero-3-phosphoethanolamine * smiles: ** c(op([o-])(occ(co)o)=o)c[n+] * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE == |
| + | * common-name: | ||
| + | ** sn-glycero-3-phosphoethanolamine | ||
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c(op([o-])(occ(co)o)=o)c[n+] |
| − | * | + | * inchi-key: |
| − | ** | + | ** jznwscpgtdbmew-rxmqykedsa-n |
| + | * molecular-weight: | ||
| + | ** 215.142 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14160]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15035]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sn-glycero-3-phosphoethanolamine}} |
| + | {{#set: inchi-key=inchikey=jznwscpgtdbmew-rxmqykedsa-n}} | ||
| + | {{#set: molecular-weight=215.142}} | ||
Revision as of 11:12, 15 January 2021
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- common-name:
- sn-glycero-3-phosphoethanolamine
- smiles:
- c(op([o-])(occ(co)o)=o)c[n+]
- inchi-key:
- jznwscpgtdbmew-rxmqykedsa-n
- molecular-weight:
- 215.142
