Difference between revisions of "DEOXYCYTIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02240 == * transcription-direction: ** negative * right-end-position: ** 215265 * left-end-position: ** 214809 * centisome-position: ** 93.19626...")
 
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02240 ==
+
== Metabolite DEOXYCYTIDINE ==
* transcription-direction:
+
* common-name:
** negative
+
** 2'-deoxycytidine
* right-end-position:
+
* smiles:
** 215265
+
** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
* left-end-position:
+
* inchi-key:
** 214809
+
** cktsbutuhbmzgz-shyzeuofsa-n
* centisome-position:
+
* molecular-weight:
** 93.19626   
+
** 227.219
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CYTIDEAM-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[ADENYL-KIN-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=2'-deoxycytidine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}}
* [[ATPASE-RXN]]
+
{{#set: molecular-weight=227.219}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12195]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12196]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5462]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7219]]
 
** '''4''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=215265}}
 
{{#set: left-end-position=214809}}
 
{{#set: centisome-position=93.19626    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=6}}
 
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite DEOXYCYTIDINE

  • common-name:
    • 2'-deoxycytidine
  • smiles:
    • c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
  • inchi-key:
    • cktsbutuhbmzgz-shyzeuofsa-n
  • molecular-weight:
    • 227.219

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality