Difference between revisions of "DEOXYGUANOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glucosyl-acyl-sphingosines == * common-name: ** a β-d-glucosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * [...") |
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * common-name: ** (r)-4'-phosphopantothenate * smiles: ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-P-PANTOTHENATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-4'-phosphopantothenate |
+ | * smiles: | ||
+ | ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c | ||
+ | * inchi-key: | ||
+ | ** xhfvghpgdldeqo-zetcqymhsa-k | ||
+ | * molecular-weight: | ||
+ | ** 296.193 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[P-PANTOCYSLIG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PANTOTHENATE-KIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-4'-phosphopantothenate}} |
+ | {{#set: inchi-key=inchikey=xhfvghpgdldeqo-zetcqymhsa-k}} | ||
+ | {{#set: molecular-weight=296.193}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite 4-P-PANTOTHENATE
- common-name:
- (r)-4'-phosphopantothenate
- smiles:
- cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c
- inchi-key:
- xhfvghpgdldeqo-zetcqymhsa-k
- molecular-weight:
- 296.193