Difference between revisions of "DEOXYINOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) * inchi-key: ** zoogrgp...") |
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) * inchi-key: ** vgontnsxdcqugy-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYINOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxyinosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vgontnsxdcqugy-rrkcrqdmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 252.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DEOXYINOPHOSPHOR-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADDALT-RXN]] |
| + | * [[DEOXYINOPHOSPHOR-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxyinosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=252.229}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DEOXYINOSINE
- common-name:
- 2'-deoxyinosine
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
- inchi-key:
- vgontnsxdcqugy-rrkcrqdmsa-n
- molecular-weight:
- 252.229
