Difference between revisions of "DEOXYINOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-O-MeCytidine4-tRNAGLY-GCC == * common-name: ** a 2'-o-methylcytidine4 in trnagly(gcc) == Reaction(s) known to consume the compound == =...") |
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) * inchi-key: ** vgontnsxdcqugy-...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEOXYINOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2'-deoxyinosine |
+ | * smiles: | ||
+ | ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) | ||
+ | * inchi-key: | ||
+ | ** vgontnsxdcqugy-rrkcrqdmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 252.229 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DEOXYINOPHOSPHOR-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ADDALT-RXN]] |
+ | * [[DEOXYINOPHOSPHOR-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2'-deoxyinosine}} |
+ | {{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}} | ||
+ | {{#set: molecular-weight=252.229}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DEOXYINOSINE
- common-name:
- 2'-deoxyinosine
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
- inchi-key:
- vgontnsxdcqugy-rrkcrqdmsa-n
- molecular-weight:
- 252.229