Difference between revisions of "DEOXYINOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-O-MeCytidine4-tRNAGLY-GCC == * common-name: ** a 2'-o-methylcytidine4 in trnagly(gcc) == Reaction(s) known to consume the compound == =...")
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) * inchi-key: ** vgontnsxdcqugy-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-O-MeCytidine4-tRNAGLY-GCC ==
+
== Metabolite DEOXYINOSINE ==
 
* common-name:
 
* common-name:
** a 2'-o-methylcytidine4 in trnagly(gcc)
+
** 2'-deoxyinosine
 +
* smiles:
 +
** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
 +
* inchi-key:
 +
** vgontnsxdcqugy-rrkcrqdmsa-n
 +
* molecular-weight:
 +
** 252.229
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DEOXYINOPHOSPHOR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12478]]
+
* [[ADDALT-RXN]]
 +
* [[DEOXYINOPHOSPHOR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2'-o-methylcytidine4 in trnagly(gcc)}}
+
{{#set: common-name=2'-deoxyinosine}}
 +
{{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}}
 +
{{#set: molecular-weight=252.229}}

Latest revision as of 11:15, 18 March 2021

Metabolite DEOXYINOSINE

  • common-name:
    • 2'-deoxyinosine
  • smiles:
    • c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
  • inchi-key:
    • vgontnsxdcqugy-rrkcrqdmsa-n
  • molecular-weight:
    • 252.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality