Difference between revisions of "DEOXYINOSINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06889 == * transcription-direction: ** positive * right-end-position: ** 456508 * left-end-position: ** 418983 * centisome-position: ** 89.40917...") |
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite RIBOFLAVIN == |
| − | * | + | * common-name: |
| − | ** | + | ** riboflavin |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** aunganrzjhbgpy-scrdcrapsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 375.36 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ARPT]] |
| − | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] | |
| − | * [[RXN | + | * [[RIBOFLAVINKIN-RXN]] |
| − | * | + | * [[RXN-12445]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RIBOFLAVIN-SYN-RXN]] |
| − | + | * [[RXN0-5187]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | {{#set: common-name=riboflavin}} |
| − | * | + | {{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}} |
| − | + | {{#set: molecular-weight=375.36}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite RIBOFLAVIN
- common-name:
- riboflavin
- smiles:
- cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
- inchi-key:
- aunganrzjhbgpy-scrdcrapsa-m
- molecular-weight:
- 375.36
