Difference between revisions of "DEOXYINOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-7830 == * common-name: ** heptadecanoate * smiles: ** ccccccccccccccccc([o-])=o * inchi-key: ** kemqgtryuadpnz-uhfffaoysa-m * molecul...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7830 == |
* common-name: | * common-name: | ||
| − | ** | + | ** heptadecanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kemqgtryuadpnz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 269.446 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=heptadecanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kemqgtryuadpnz-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=269.446}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-7830
- common-name:
- heptadecanoate
- smiles:
- ccccccccccccccccc([o-])=o
- inchi-key:
- kemqgtryuadpnz-uhfffaoysa-m
- molecular-weight:
- 269.446
