Difference between revisions of "DEOXYURIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
(Created page with "Category:metabolite == Metabolite Protein-tauphospho-L-histidines == * common-name: ** a [protein]-nτ-phospho-l-histidine == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-tauphospho-L-histidines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-nτ-phospho-l-histidine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17132]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-nτ-phospho-l-histidine}} |
| − | |||
| − | |||
Revision as of 18:56, 14 January 2021
Contents
Metabolite Protein-tauphospho-L-histidines
- common-name:
- a [protein]-nτ-phospho-l-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-nτ-phospho-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
