Difference between revisions of "DEOXYURIDINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** mxhrcpnrjammim-shyze...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17050 ==
+
== Metabolite DEOXYURIDINE ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** 2'-deoxyuridine
 
* smiles:
 
* smiles:
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
+
** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
 
* inchi-key:
 
* inchi-key:
** poiijaagmgnxlo-vxgbxaggsa-n
+
** mxhrcpnrjammim-shyzeuofsa-n
 
* molecular-weight:
 
* molecular-weight:
** 296.358
+
** 228.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[URA-PHOSPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
+
* [[CYTIDEAM-RXN]]
 +
* [[RXN-14143]]
 +
* [[URA-PHOSPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=2'-deoxyuridine}}
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
{{#set: molecular-weight=296.358}}
+
{{#set: molecular-weight=228.204}}

Latest revision as of 11:15, 18 March 2021

Metabolite DEOXYURIDINE

  • common-name:
    • 2'-deoxyuridine
  • smiles:
    • c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
  • inchi-key:
    • mxhrcpnrjammim-shyzeuofsa-n
  • molecular-weight:
    • 228.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality