Difference between revisions of "DEOXYURIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...") |
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** mxhrcpnrjammim-shyze...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEOXYURIDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2'-deoxyuridine |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mxhrcpnrjammim-shyzeuofsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 228.204 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[URA-PHOSPH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[CYTIDEAM-RXN]] |
+ | * [[RXN-14143]] | ||
+ | * [[URA-PHOSPH-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2'-deoxyuridine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.204}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DEOXYURIDINE
- common-name:
- 2'-deoxyuridine
- smiles:
- c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
- inchi-key:
- mxhrcpnrjammim-shyzeuofsa-n
- molecular-weight:
- 228.204