Difference between revisions of "DEOXYXYLULOSE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...")
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-558 ==
+
== Metabolite CINNAMOYL-COA ==
 
* common-name:
 
* common-name:
** pimeloyl-coa
+
** (e)-cinnamoyl-coa
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lycrxmtyuzduga-uyrkptjqsa-i
+
** jvnvhnhitfvwix-kzkudurgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 904.649
+
** 893.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[7KAPSYN-RXN]]
+
* [[RXN-7645]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-2001]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimeloyl-coa}}
+
{{#set: common-name=(e)-cinnamoyl-coa}}
{{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}}
+
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
{{#set: molecular-weight=904.649}}
+
{{#set: molecular-weight=893.648}}

Revision as of 08:26, 15 March 2021

Metabolite CINNAMOYL-COA

  • common-name:
    • (e)-cinnamoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • jvnvhnhitfvwix-kzkudurgsa-j
  • molecular-weight:
    • 893.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality