Difference between revisions of "DEOXYXYLULOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15996 == * transcription-direction: ** positive * right-end-position: ** 85797 * left-end-position: ** 75341 * centisome-position: ** 26.118988...") |
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DEOXYXYLULOSE-5P == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-deoxy-d-xylulose 5-phosphate |
| − | + | * smiles: | |
| − | + | ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] | |
| − | + | * inchi-key: | |
| − | * | + | ** ajpadpzsrrughi-rfzpgflssa-l |
| − | + | * molecular-weight: | |
| − | ** | + | ** 212.096 |
| − | = | + | == Reaction(s) known to consume the compound == |
| − | + | * [[DXPREDISOM-RXN]] | |
| − | = | + | * [[THIAZOLSYN2-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[DXPREDISOM-RXN]] |
| − | ** | + | * [[DXS-RXN]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1-deoxy-d-xylulose 5-phosphate}} | |
| − | ** | + | {{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}} |
| − | * [[RXN | + | {{#set: molecular-weight=212.096}} |
| − | * | ||
| − | |||
| − | * [[RXN | ||
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DEOXYXYLULOSE-5P
- common-name:
- 1-deoxy-d-xylulose 5-phosphate
- smiles:
- cc(=o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ajpadpzsrrughi-rfzpgflssa-l
- molecular-weight:
- 212.096
