Difference between revisions of "DEOXYXYLULOSE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE ==
+
== Metabolite DEOXYXYLULOSE-5P ==
 
* common-name:
 
* common-name:
** a [protein] c-terminal s-farnesyl-l-cysteine
+
** 1-deoxy-d-xylulose 5-phosphate
 +
* smiles:
 +
** cc(=o)c(o)c(o)cop([o-])(=o)[o-]
 +
* inchi-key:
 +
** ajpadpzsrrughi-rfzpgflssa-l
 +
* molecular-weight:
 +
** 212.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.100-RXN]]
+
* [[DXPREDISOM-RXN]]
 +
* [[THIAZOLSYN2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11698]]
+
* [[DXPREDISOM-RXN]]
* [[RXN-8409]]
+
* [[DXS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein] c-terminal s-farnesyl-l-cysteine}}
+
{{#set: common-name=1-deoxy-d-xylulose 5-phosphate}}
 +
{{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}}
 +
{{#set: molecular-weight=212.096}}

Latest revision as of 11:13, 18 March 2021

Metabolite DEOXYXYLULOSE-5P

  • common-name:
    • 1-deoxy-d-xylulose 5-phosphate
  • smiles:
    • cc(=o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • ajpadpzsrrughi-rfzpgflssa-l
  • molecular-weight:
    • 212.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality