Difference between revisions of "DEOXYXYLULOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14344 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DEOXYXYLULOSE-5P == |
− | = | + | * common-name: |
− | * | + | ** 1-deoxy-d-xylulose 5-phosphate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] |
− | * | + | * inchi-key: |
− | + | ** ajpadpzsrrughi-rfzpgflssa-l | |
− | * [[RXN | + | * molecular-weight: |
− | * | + | ** 212.096 |
− | + | == Reaction(s) known to consume the compound == | |
− | == | + | * [[DXPREDISOM-RXN]] |
− | + | * [[THIAZOLSYN2-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[DXPREDISOM-RXN]] |
− | {{#set: | + | * [[DXS-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
+ | {{#set: common-name=1-deoxy-d-xylulose 5-phosphate}} | ||
+ | {{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}} | ||
+ | {{#set: molecular-weight=212.096}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DEOXYXYLULOSE-5P
- common-name:
- 1-deoxy-d-xylulose 5-phosphate
- smiles:
- cc(=o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ajpadpzsrrughi-rfzpgflssa-l
- molecular-weight:
- 212.096