Difference between revisions of "DEPHOSPHO-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00759 == * transcription-direction: ** negative * right-end-position: ** 81184 * left-end-position: ** 75182 * centisome-position: ** 46.36085...") |
(Created page with "Category:metabolite == Metabolite DEPHOSPHO-COA == * common-name: ** 3'-dephospho-coa * smiles: ** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DEPHOSPHO-COA == |
− | * | + | * common-name: |
− | ** | + | ** 3'-dephospho-coa |
− | * | + | * smiles: |
− | ** | + | ** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs |
− | * | + | * inchi-key: |
− | ** | + | ** kdtshfargakyjn-ibosznhhsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 685.538 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ADCPT]] |
− | == Reaction(s) | + | * [[DEPHOSPHOCOAKIN-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[PANTEPADENYLYLTRAN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=3'-dephospho-coa}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}} |
− | + | {{#set: molecular-weight=685.538}} | |
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DEPHOSPHO-COA
- common-name:
- 3'-dephospho-coa
- smiles:
- cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
- inchi-key:
- kdtshfargakyjn-ibosznhhsa-l
- molecular-weight:
- 685.538