Difference between revisions of "DEPHOSPHO-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common-name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * inchi-key: ** xzeuytksayn...") |
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14407 == |
* common-name: | * common-name: | ||
− | ** | + | ** dihomo γ-linolenoyl-coa |
+ | * smiles: | ||
+ | ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fjwjalrunnzibb-ddquopdjsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1051.975 |
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13435]] |
+ | * [[RXN-16044]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12971]] |
+ | * [[RXN-17105]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dihomo γ-linolenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1051.975}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-14407
- common-name:
- dihomo γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- fjwjalrunnzibb-ddquopdjsa-j
- molecular-weight:
- 1051.975