Difference between revisions of "DEPHOSPHO-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite Oxidized-hemoproteins == * common-name: ** an oxidized hemoprotein == Reaction(s) known to consume the compound == * NADPH--FERRIHEMOPR...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14407 ==
+
== Metabolite Oxidized-hemoproteins ==
 
* common-name:
 
* common-name:
** dihomo γ-linolenoyl-coa
+
** an oxidized hemoprotein
* smiles:
 
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fjwjalrunnzibb-ddquopdjsa-j
 
* molecular-weight:
 
** 1051.975
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13435]]
+
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
* [[RXN-16044]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12971]]
 
* [[RXN-17105]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=an oxidized hemoprotein}}
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
 
{{#set: molecular-weight=1051.975}}
 

Revision as of 15:26, 5 January 2021

Metabolite Oxidized-hemoproteins

  • common-name:
    • an oxidized hemoprotein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality