Difference between revisions of "DETHIOBIOTIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00495 == * transcription-direction: ** negative * right-end-position: ** 16242 * left-end-position: ** 31 * centisome-position: ** 5.459707400e-3 =...") |
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DETHIOBIOTIN == |
| − | * | + | * common-name: |
| − | ** | + | ** dethiobiotin |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(nc(=o)nc1cccccc(=o)[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** autolbmxddtrrt-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 213.256 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| − | == Reaction(s) | + | * [[RXN-17472]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[DETHIOBIOTIN-SYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=dethiobiotin}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}} |
| − | + | {{#set: molecular-weight=213.256}} | |
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DETHIOBIOTIN
- common-name:
- dethiobiotin
- smiles:
- cc1(nc(=o)nc1cccccc(=o)[o-])
- inchi-key:
- autolbmxddtrrt-uhfffaoysa-m
- molecular-weight:
- 213.256
