Difference between revisions of "DETHIOBIOTIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...")
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17046 ==
+
== Metabolite DETHIOBIOTIN ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** dethiobiotin
 
* smiles:
 
* smiles:
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** cc1(nc(=o)nc1cccccc(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** yjisldwviydioe-wgtgpsahsa-l
+
** autolbmxddtrrt-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 842.848
+
** 213.256
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15681]]
+
* [[2.8.1.6-RXN]]
 +
* [[RXN-17472]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15680]]
+
* [[DETHIOBIOTIN-SYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=dethiobiotin}}
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
+
{{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}}
{{#set: molecular-weight=842.848}}
+
{{#set: molecular-weight=213.256}}

Latest revision as of 11:11, 18 March 2021

Metabolite DETHIOBIOTIN

  • common-name:
    • dethiobiotin
  • smiles:
    • cc1(nc(=o)nc1cccccc(=o)[o-])
  • inchi-key:
    • autolbmxddtrrt-uhfffaoysa-m
  • molecular-weight:
    • 213.256

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality