Difference between revisions of "DETOX1-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...")
(Created page with "Category:pathway == Pathway DETOX1-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** superoxide radicals degradation == Reaction(s) found == * CATAL-RXN...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] ==
+
== Pathway DETOX1-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** adenosine
+
** superoxide radicals degradation
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+
* [[CATAL-RXN]]
* inchi-key:
+
* [[SUPEROX-DISMUT-RXN]]
** oirdtqyftabqoq-kqynxxcusa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 267.244
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=superoxide radicals degradation}}
* [[ADENODEAMIN-RXN]]
+
{{#set: nb reaction found=2}}
* [[ADENOSINE-KINASE-RXN]]
+
{{#set: completion rate=1.0}}
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
{{#set: nb total reaction=2}}
* [[ADENPHOSPHOR-RXN]]
 
* [[ADNK]]
 
* [[ADNKm]]
 
== Reaction(s) known to produce the compound ==
 
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 
* [[ADENPHOSPHOR-RXN]]
 
* [[AMP-DEPHOSPHORYLATION-RXN]]
 
* [[AMP5N]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=adenosine}}
 
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
 
{{#set: molecular-weight=267.244}}
 

Latest revision as of 10:59, 18 March 2021

Pathway DETOX1-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • superoxide radicals degradation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present