Difference between revisions of "DETOX1-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-LACTATE D-LACTATE] == * common-name: ** (r)-lactate * smiles: ** cc(c([o-])=o)o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oirdtqyftabqoq-kqynxxcusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 267.244 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ADENODEAMIN-RXN]] |
| + | * [[ADENOSINE-KINASE-RXN]] | ||
| + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] | ||
| + | * [[ADENPHOSPHOR-RXN]] | ||
| + | * [[ADNK]] | ||
| + | * [[ADNKm]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
| − | * [[ | + | * [[ADENPHOSPHOR-RXN]] |
| − | * [[ | + | * [[AMP-DEPHOSPHORYLATION-RXN]] |
| + | * [[AMP5N]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=267.244}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite ADENOSINE
- common-name:
- adenosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- oirdtqyftabqoq-kqynxxcusa-n
- molecular-weight:
- 267.244
