Difference between revisions of "DETOX1-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...")
(Created page with "Category:pathway == Pathway PWYQT-4476 == * taxonomic-range: ** tax-3699 * common-name: ** indole glucosinolate activation (herbivore attack) == Reaction(s) found == * R...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] ==
+
== Pathway PWYQT-4476 ==
 +
* taxonomic-range:
 +
** tax-3699
 
* common-name:
 
* common-name:
−
** adenosine
+
** indole glucosinolate activation (herbivore attack)
−
* smiles:
+
== Reaction(s) found ==
−
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
+
* [[RXN-1404]]
−
* inchi-key:
+
== Reaction(s) not found ==
−
** oirdtqyftabqoq-kqynxxcusa-n
+
* [NoneRXN-18230 RXN-18230]
−
* molecular-weight:
+
* [NoneRXNQT-4355 RXNQT-4355]
−
** 267.244
+
* [NoneRXNQT-4351 RXNQT-4351]
−
== Reaction(s) known to consume the compound ==
+
* [NoneRXNQT-4350 RXNQT-4350]
−
* [[ADENODEAMIN-RXN]]
+
* [NoneRXNQT-4356 RXNQT-4356]
−
* [[ADENOSINE-KINASE-RXN]]
+
* [NoneRXNQT-4357 RXNQT-4357]
−
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [NoneRXNQT-4358 RXNQT-4358]
−
* [[ADENPHOSPHOR-RXN]]
+
* [NoneRXNQT-4352 RXNQT-4352]
−
* [[ADNK]]
+
* [NoneRXNQT-4353 RXNQT-4353]
−
* [[ADNKm]]
+
* [NoneRXN-12205 RXN-12205]
−
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-12206 RXN-12206]
−
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [NoneRXN-1444 RXN-1444]
−
* [[ADENPHOSPHOR-RXN]]
+
{{#set: taxonomic-range=tax-3699}}
−
* [[AMP-DEPHOSPHORYLATION-RXN]]
+
{{#set: common-name=indole glucosinolate activation (herbivore attack)}}
−
* [[AMP5N]]
+
{{#set: nb reaction found=1}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.08}}
−
{{#set: common-name=adenosine}}
+
{{#set: nb total reaction=13}}
−
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
 
−
{{#set: molecular-weight=267.244}}
 

Revision as of 20:18, 18 December 2020

Pathway PWYQT-4476

  • taxonomic-range:
    • tax-3699
  • common-name:
    • indole glucosinolate activation (herbivore attack)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-18230 RXN-18230]
  • [NoneRXNQT-4355 RXNQT-4355]
  • [NoneRXNQT-4351 RXNQT-4351]
  • [NoneRXNQT-4350 RXNQT-4350]
  • [NoneRXNQT-4356 RXNQT-4356]
  • [NoneRXNQT-4357 RXNQT-4357]
  • [NoneRXNQT-4358 RXNQT-4358]
  • [NoneRXNQT-4352 RXNQT-4352]
  • [NoneRXNQT-4353 RXNQT-4353]
  • [NoneRXN-12205 RXN-12205]
  • [NoneRXN-12206 RXN-12206]
  • [NoneRXN-1444 RXN-1444]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DETOX1-PWY&oldid=39943"