Difference between revisions of "DGDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(...")
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE ==
+
== Metabolite CPD-207 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (3,4)-bisphosphate
+
** phenylacetyl-coa
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mckajxmrulsuki-cnwjwelysa-j
+
** zigifdrjfzyeeq-cecatxlmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 881.637
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10960]]
+
* [[RXN-10821]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10939]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
+
{{#set: common-name=phenylacetyl-coa}}
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
+
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=881.637}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-207

  • common-name:
    • phenylacetyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • zigifdrjfzyeeq-cecatxlmsa-j
  • molecular-weight:
    • 881.637

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality