|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UNSPECIFIC-MONOOXYGENASE-RXN UNSPECIFIC-MONOOXYGENASE-RXN] == | + | == Metabolite DGDP == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** dgdp |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.14.14.1 ec-1.14.14.1] | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[RH-Group]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[Alcohols]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
| + | ** cikgwctvfsrmju-kvqbguixsa-k |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 424.18 |
| − | * Gene: [[SJ05072]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[orthology]] | + | * [[ATDGD]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[DGDPKIN-RXN]] |
| − | * Gene: [[SJ05370]]
| + | * [[DGTPtm]] |
| − | ** Category: [[orthology]]
| + | * [[RXN-14207]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-14218]] |
| − | * Gene: [[SJ07227]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | * [[ATDGM]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[DGOTO]] |
| − | * Gene: [[SJ03397]] | + | * [[DGTCY]] |
| − | ** Category: [[orthology]] | + | * [[DGTPtm]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[DGTUP]] |
| − | * Gene: [[SJ18127]]
| + | * [[GDPREDUCT-RXN]] |
| − | ** Category: [[orthology]] | + | * [[RXN-14217]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN0-748]] |
| − | * Gene: [[SJ12861]] | + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]] | + | {{#set: common-name=dgdp}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}} |
| − | * Gene: [[SJ19505]] | + | {{#set: molecular-weight=424.18}} |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ05110]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ09087]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ07228]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links ==
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04122 R04122]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P04800 P04800]
| |
| − | ** [http://www.uniprot.org/uniprot/Q06884 Q06884]
| |
| − | ** [http://www.uniprot.org/uniprot/P10632 P10632]
| |
| − | ** [http://www.uniprot.org/uniprot/P14779 P14779]
| |
| − | ** [http://www.uniprot.org/uniprot/O08336 O08336]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M0C2 Q7M0C2]
| |
| − | ** [http://www.uniprot.org/uniprot/P00185 P00185]
| |
| − | ** [http://www.uniprot.org/uniprot/P00176 P00176]
| |
| − | ** [http://www.uniprot.org/uniprot/P49602 P49602]
| |
| − | ** [http://www.uniprot.org/uniprot/P43083 P43083]
| |
| − | ** [http://www.uniprot.org/uniprot/Q12573 Q12573]
| |
| − | ** [http://www.uniprot.org/uniprot/O04892 O04892]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: ec-number=ec-1.14.14.1}} | |
| − | {{#set: nb gene associated=10}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology}}
| |
| − | {{#set: reconstruction tool=pantograph}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
| |
