Difference between revisions of "DGDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DGDP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dgdp |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cikgwctvfsrmju-kvqbguixsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 424.18 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDGD]] | ||
| + | * [[DGDPKIN-RXN]] | ||
| + | * [[DGTPtm]] | ||
| + | * [[RXN-14207]] | ||
| + | * [[RXN-14218]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ATDGM]] |
| − | * [[ | + | * [[DGOTO]] |
| − | * [[ | + | * [[DGTCY]] |
| − | * [[ | + | * [[DGTPtm]] |
| + | * [[DGTUP]] | ||
| + | * [[GDPREDUCT-RXN]] | ||
| + | * [[RXN-14217]] | ||
| + | * [[RXN0-748]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dgdp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=424.18}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite DGDP
- common-name:
- dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- cikgwctvfsrmju-kvqbguixsa-k
- molecular-weight:
- 424.18
