Difference between revisions of "DGDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PUTRESCINE == * common-name: ** putrescine * smiles: ** c([n+])ccc[n+] * inchi-key: ** kidhwzjucrjvml-uhfffaoysa-p * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PUTRESCINE ==
+
== Metabolite DGDP ==
 
* common-name:
 
* common-name:
** putrescine
+
** dgdp
 
* smiles:
 
* smiles:
** c([n+])ccc[n+]
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** kidhwzjucrjvml-uhfffaoysa-p
+
** cikgwctvfsrmju-kvqbguixsa-k
 
* molecular-weight:
 
* molecular-weight:
** 90.168
+
** 424.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ABC-25-RXN]]
+
* [[ATDGD]]
* [[APAPT]]
+
* [[DGDPKIN-RXN]]
* [[SPERMIDINESYN-RXN]]
+
* [[DGTPtm]]
* [[TRANS-RXN-69]]
+
* [[RXN-14207]]
 +
* [[RXN-14218]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ABC-25-RXN]]
+
* [[ATDGM]]
* [[AGMATIN-RXN]]
+
* [[DGOTO]]
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
+
* [[DGTCY]]
* [[ORDC]]
+
* [[DGTPtm]]
* [[ORNDECARBOX-RXN]]
+
* [[DGTUP]]
* [[SPERMIDINESYN-RXN]]
+
* [[GDPREDUCT-RXN]]
* [[TRANS-RXN-69]]
+
* [[RXN-14217]]
 +
* [[RXN0-748]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=putrescine}}
+
{{#set: common-name=dgdp}}
{{#set: inchi-key=inchikey=kidhwzjucrjvml-uhfffaoysa-p}}
+
{{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}}
{{#set: molecular-weight=90.168}}
+
{{#set: molecular-weight=424.18}}

Latest revision as of 11:18, 18 March 2021

Metabolite DGDP

  • common-name:
    • dgdp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • cikgwctvfsrmju-kvqbguixsa-k
  • molecular-weight:
    • 424.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality