|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ05782 == | + | == Metabolite DGMP == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** dgmp |
| − | * right-end-position: | + | * smiles: |
| − | ** 394840 | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 380014
| + | ** ltfmzdnnppeqng-kvqbguixsa-l |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 77.94439
| + | ** 345.208 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[ATDGM]] |
| − | == Reaction(s) associated == | + | * [[DMPH]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[3.2.1.21-RXN]] | + | * [[DGTD]] |
| − | ** Category: [[annotation]]
| + | * [[DMPH]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | * [[RXN-14208]] |
| − | * [[3.2.1.39-RXN]]
| + | * [[RXN-14218]] |
| − | ** Category: [[annotation]]
| + | * [[RXN0-385]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=dgmp}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}} |
| − | * [[RXN-10769]]
| + | {{#set: molecular-weight=345.208}} |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10773]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-13602]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-13603]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-14179]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-2043]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-5341]] | |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-8036]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-9674]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN0-5395]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-6788]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7091]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7092]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-3121]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5176]]
| |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6002]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=394840}} | |
| − | {{#set: left-end-position=380014}}
| |
| − | {{#set: centisome-position=77.94439 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=12}}
| |
| − | {{#set: nb pathway associated=6}}
| |
