Difference between revisions of "DGTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...")
(Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEOXYGUANOSINE ==
+
== Metabolite CPD-13855 ==
 
* common-name:
 
* common-name:
** 2'-deoxyguanosine
+
** n7-methylguanosine 5'-diphosphate
 
* smiles:
 
* smiles:
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
 
* inchi-key:
 
* inchi-key:
** ykbgvtzyehremt-kvqbguixsa-n
+
** sbasprrecyvbrf-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 267.244
+
** 455.214
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
+
* [[RXN-12817]]
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
+
* [[RXN-12817]]
* [[DGTPTRIPHYDRO-RXN]]
 
* [[DMPH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyguanosine}}
+
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
+
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
{{#set: molecular-weight=267.244}}
+
{{#set: molecular-weight=455.214}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-13855

  • common-name:
    • n7-methylguanosine 5'-diphosphate
  • smiles:
    • c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
  • inchi-key:
    • sbasprrecyvbrf-kqynxxcusa-l
  • molecular-weight:
    • 455.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality