Difference between revisions of "DGTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.137-RXN 2.1.1.137-RXN] == * direction: ** left-to-right * common-name: ** s-adenosyl-l-methio...")
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.137-RXN 2.1.1.137-RXN] ==
+
== Metabolite DGTP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** s-adenosyl-l-methionine:arsenite as-methyltransferase
+
** dgtp
−
** arsenite methyltransferase
+
* smiles:
−
* ec-number:
+
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
** [http://enzyme.expasy.org/EC/2.1.1.137 ec-2.1.1.137]
+
* inchi-key:
−
== Reaction formula ==
+
** haazlughyhwqiw-kvqbguixsa-j
−
* 1 [[CPD-763]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[METHYLARSONATE]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 503.152
−
* Gene: [[SJ06973]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[DGTCY]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DGTD]]
−
* Gene: [[SJ19252]]
+
* [[DGTPTRIPHYDRO-RXN]]
−
** Category: [[annotation]]
+
* [[DGTPtm]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[DGTUP]]
−
== Pathway(s) ==
+
* [[RXN-14208]]
−
* [[PWY-4202]], arsenate detoxification I (glutaredoxin): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4202 PWY-4202]
+
* [[RXN-14217]]
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN0-385]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATDGD]]
−
== External links  ==
+
* [[DGDPKIN-RXN]]
−
* RHEA:
+
* [[DGTPtm]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15294 15294]
+
* [[RXN-14207]]
−
* LIGAND-RXN:
+
* [[RXN0-746]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R05755 R05755]
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=dgtp}}
−
{{#set: common-name=arsenite methyltransferase|s-adenosyl-l-methionine:arsenite as-methyltransferase}}
+
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
−
{{#set: ec-number=ec-2.1.1.137}}
+
{{#set: molecular-weight=503.152}}
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DGTP

  • common-name:
    • dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • haazlughyhwqiw-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DGTP&oldid=139265"