Difference between revisions of "DGTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.170-RXN 1.1.1.170-RXN] == * direction: ** reversible * common-name: ** 3β-hydroxy-4&beta...")
 
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.170-RXN 1.1.1.170-RXN] ==
+
== Metabolite DGTP ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate 3-dehydrogenase, decarboxylating
+
** dgtp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.170 ec-1.1.1.170]
+
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-5846]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
** haazlughyhwqiw-kvqbguixsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ04782]]
+
** 503.152
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DGTCY]]
== Pathway(s) ==
+
* [[DGTD]]
== Reconstruction information  ==
+
* [[DGTPTRIPHYDRO-RXN]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DGTPtm]]
== External links  ==
+
* [[DGTUP]]
* RHEA:
+
* [[RXN-14208]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20676 20676]
+
* [[RXN-14217]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20672 20672]
+
* [[RXN0-385]]
* LIGAND-RXN:
+
== Reaction(s) known to produce the compound ==
** [http://www.genome.jp/dbget-bin/www_bget?R07149 R07149]
+
* [[ATDGD]]
{{#set: direction=reversible}}
+
* [[DGDPKIN-RXN]]
{{#set: common-name=3&beta;-hydroxy-4&beta;-methyl-5&alpha;-cholest-7-ene-4&alpha;-carboxylate 3-dehydrogenase, decarboxylating}}
+
* [[DGTPtm]]
{{#set: ec-number=ec-1.1.1.170}}
+
* [[RXN-14207]]
{{#set: nb gene associated=1}}
+
* [[RXN0-746]]
{{#set: nb pathway associated=0}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction category=annotation}}
+
{{#set: common-name=dgtp}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=503.152}}
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DGTP

  • common-name:
    • dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • haazlughyhwqiw-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality