|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.6.5.4-RXN 1.6.5.4-RXN] == | + | == Metabolite DI-H-OROTATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** nadh-monodehydroascorbate reductase | + | ** (s)-dihydroorotate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.6.5.4 ec-1.6.5.4] | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 2 [[CPD-318]][c] '''+''' 1 [[NADH]][c] '''=>''' 2 [[ASCORBATE]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[PROTON]][c]
| + | ** ufivepvsagbusi-reohclbhsa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ04254]] | + | ** 157.105 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[DIHYDROOROT-RXN]] |
| − | ** Category: [[orthology]]
| + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN0-6491]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN0-6554]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ15624]]
| + | * [[DIHYDROOROT-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=(s)-dihydroorotate}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=157.105}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-6370]], ascorbate recycling (cytosolic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] | |
| − | ** '''2''' reactions found over '''6''' reactions in the full pathway | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14582 14582]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00095 R00095]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9S926 Q9S926]
| |
| − | ** [http://www.uniprot.org/uniprot/Q40977 Q40977]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42711 Q42711]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43497 Q43497]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=nadh-monodehydroascorbate reductase}} | |
| − | {{#set: ec-number=ec-1.6.5.4}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
