Difference between revisions of "DI-H-OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08338 == * transcription-direction: ** positive * right-end-position: ** 362595 * left-end-position: ** 345792 * centisome-position: ** 78.30683...") |
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DI-H-OROTATE == |
| − | * | + | * common-name: |
| − | ** | + | ** (s)-dihydroorotate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ufivepvsagbusi-reohclbhsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 157.105 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DIHYDROOROT-RXN]] |
| − | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | |
| − | * [[ | + | * [[RXN0-6491]] |
| − | * | + | * [[RXN0-6554]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[DIHYDROOROT-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=(s)-dihydroorotate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} |
| − | + | {{#set: molecular-weight=157.105}} | |
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105
