Difference between revisions of "DI-H-OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18888 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...") |
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DI-H-OROTATE == |
| + | * common-name: | ||
| + | ** (s)-dihydroorotate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ufivepvsagbusi-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 157.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DIHYDROOROT-RXN]] |
| + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DIHYDROOROT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-dihydroorotate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} |
| + | {{#set: molecular-weight=157.105}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105
