Difference between revisions of "DI-H-OROTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11319 RXN-11319] == * direction: ** left-to-right * common-name: ** 2-iminoacetate synthase * e...")
 
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11319 RXN-11319] ==
+
== Metabolite DI-H-OROTATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 2-iminoacetate synthase
+
** (s)-dihydroorotate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.99.19 ec-4.1.99.19]
+
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADPH]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[TYR]][c] '''=>''' 1 [[CH33ADO]][c] '''+''' 1 [[CPD-108]][c] '''+''' 1 [[CPD-12279]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[PROTON]][c]
+
** ufivepvsagbusi-reohclbhsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17412]]
+
** 157.105
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[DIHYDROOROT-RXN]]
−
== Pathway(s) ==
+
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
−
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
* [[RXN0-6491]]
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN0-6554]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DIHYDROOROT-RXN]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
* LIGAND-RXN:
+
{{#set: common-name=(s)-dihydroorotate}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R10246 R10246]
+
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}
−
* RHEA:
+
{{#set: molecular-weight=157.105}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26364 26364]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=2-iminoacetate synthase}}
 
−
{{#set: ec-number=ec-4.1.99.19}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite DI-H-OROTATE

  • common-name:
    • (s)-dihydroorotate
  • smiles:
    • c1(c(=o)nc(=o)nc(c(=o)[o-])1)
  • inchi-key:
    • ufivepvsagbusi-reohclbhsa-m
  • molecular-weight:
    • 157.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DI-H-OROTATE&oldid=138575"