Difference between revisions of "DIACYLGLYCEROL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...")
(Created page with "Category:metabolite == Metabolite DIACYLGLYCEROL-PYROPHOSPHATE == * common-name: ** a 1,2-diacyl-sn-glycerol 3-diphosphate == Reaction(s) known to consume the compound ==...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL-PYRUVATE ==
+
== Metabolite DIACYLGLYCEROL-PYROPHOSPHATE ==
 
* common-name:
 
* common-name:
** keto-phenylpyruvate
+
** a 1,2-diacyl-sn-glycerol 3-diphosphate
* smiles:
 
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 
* inchi-key:
 
** btnmpgbkdvtsjy-uhfffaoysa-m
 
* molecular-weight:
 
** 163.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-11277]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[PPDH]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-phenylpyruvate}}
+
{{#set: common-name=a 1,2-diacyl-sn-glycerol 3-diphosphate}}
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
 
{{#set: molecular-weight=163.152}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DIACYLGLYCEROL-PYROPHOSPHATE

  • common-name:
    • a 1,2-diacyl-sn-glycerol 3-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality